C33H30N4O4S — CID 2432161
N,4-dimethyl-N-[[4-[[[2-(4-methylphenyl)quinoline-4-carbonyl]amino]carbamoyl]phenyl]methyl]benzenesulfonamide (PubChem CID 2432161) has the molecular formula C33H30N4O4S and a molecular weight of 578.69 g/mol. Its IUPAC name is N,4-dimethyl-N-[[4-[[[2-(4-methylphenyl)quinoline-4-carbonyl]amino]carbamoyl]phenyl]methyl]benzenesulfonamide.
| Compound Name | N,4-dimethyl-N-[[4-[[[2-(4-methylphenyl)quinoline-4-carbonyl]amino]carbamoyl]phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2432161 |
| Molecular Formula | C33H30N4O4S |
| Molecular Weight | 578.69 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | N,4-dimethyl-N-[[4-[[[2-(4-methylphenyl)quinoline-4-carbonyl]amino]carbamoyl]phenyl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NNC(=O)c3ccc(CN(C)S(=O)(=O)c4ccc(C)cc4)cc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C33H30N4O4S/c1-22-8-14-25(15-9-22)31-20-29(28-6-4-5-7-30(28)34-31)33(39)36-35-32(38)26-16-12-24(13-17-26)21-37(3)42(40,41)27-18-10-23(2)11-19-27/h4-20H,21H2,1-3H3,(H,35,38)(H,36,39) |
| InChIKey | DNWGMPIRTCLBKR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.69 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|