C23H21F2N3O4S — CID 2379105
N-[[4-[[(2,6-difluorobenzoyl)amino]carbamoyl]phenyl]methyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 2379105) has the molecular formula C23H21F2N3O4S and a molecular weight of 473.50 g/mol. Its IUPAC name is N-[[4-[[(2,6-difluorobenzoyl)amino]carbamoyl]phenyl]methyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[[4-[[(2,6-difluorobenzoyl)amino]carbamoyl]phenyl]methyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 2379105 |
| Molecular Formula | C23H21F2N3O4S |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | N-[[4-[[(2,6-difluorobenzoyl)amino]carbamoyl]phenyl]methyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)Cc2ccc(C(=O)NNC(=O)c3c(F)cccc3F)cc2)cc1 |
| InChI | InChI=1S/C23H21F2N3O4S/c1-15-6-12-18(13-7-15)33(31,32)28(2)14-16-8-10-17(11-9-16)22(29)26-27-23(30)21-19(24)4-3-5-20(21)25/h3-13H,14H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | QSCVYVKXCKIRHJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|