C20H21N3O5S3 — CID 2507621
N,4-dimethyl-N-[[4-[(thiophen-2-ylsulfonylamino)carbamoyl]phenyl]methyl]benzenesulfonamide (PubChem CID 2507621) has the molecular formula C20H21N3O5S3 and a molecular weight of 479.61 g/mol. Its IUPAC name is N,4-dimethyl-N-[[4-[(thiophen-2-ylsulfonylamino)carbamoyl]phenyl]methyl]benzenesulfonamide.
| Compound Name | N,4-dimethyl-N-[[4-[(thiophen-2-ylsulfonylamino)carbamoyl]phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2507621 |
| Molecular Formula | C20H21N3O5S3 |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | N,4-dimethyl-N-[[4-[(thiophen-2-ylsulfonylamino)carbamoyl]phenyl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)Cc2ccc(C(=O)NNS(=O)(=O)c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C20H21N3O5S3/c1-15-5-11-18(12-6-15)31(27,28)23(2)14-16-7-9-17(10-8-16)20(24)21-22-30(25,26)19-4-3-13-29-19/h3-13,22H,14H2,1-2H3,(H,21,24) |
| InChIKey | REVNBDGUEMBBHX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|