C11H9ClN2O3S2 — CID 8500420
4-chloro-N'-thiophen-2-ylsulfonylbenzohydrazide (PubChem CID 8500420) has the molecular formula C11H9ClN2O3S2 and a molecular weight of 316.79 g/mol. Its IUPAC name is 4-chloro-N'-thiophen-2-ylsulfonylbenzohydrazide.
| Compound Name | 4-chloro-N'-thiophen-2-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 8500420 |
| Molecular Formula | C11H9ClN2O3S2 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 4-chloro-N'-thiophen-2-ylsulfonylbenzohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1cccs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H9ClN2O3S2/c12-9-5-3-8(4-6-9)11(15)13-14-19(16,17)10-2-1-7-18-10/h1-7,14H,(H,13,15) |
| InChIKey | KYVINLDXKDJYAO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|