C19H16ClN3O4S3 — CID 166191023
N-[3-[[[2-(4-chlorophenyl)sulfanylacetyl]amino]carbamoyl]phenyl]thiophene-2-sulfonamide (PubChem CID 166191023) has the molecular formula C19H16ClN3O4S3 and a molecular weight of 482.01 g/mol. Its IUPAC name is N-[3-[[[2-(4-chlorophenyl)sulfanylacetyl]amino]carbamoyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-[[[2-(4-chlorophenyl)sulfanylacetyl]amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 166191023 |
| Molecular Formula | C19H16ClN3O4S3 |
| Molecular Weight | 482.01 g/mol |
| Exact Mass | 481.00 |
| IUPAC Name | N-[3-[[[2-(4-chlorophenyl)sulfanylacetyl]amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)NNC(=O)c1cccc(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C19H16ClN3O4S3/c20-14-6-8-16(9-7-14)29-12-17(24)21-22-19(25)13-3-1-4-15(11-13)23-30(26,27)18-5-2-10-28-18/h1-11,23H,12H2,(H,21,24)(H,22,25) |
| InChIKey | GCXMSBROUHKQNR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.01 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|