C19H14Cl3N3O4S3 — CID 4847454
2,5-dichloro-N-[4-[[[2-(4-chlorophenyl)sulfanylacetyl]amino]carbamoyl]phenyl]thiophene-3-sulfonamide (PubChem CID 4847454) has the molecular formula C19H14Cl3N3O4S3 and a molecular weight of 550.90 g/mol. Its IUPAC name is 2,5-dichloro-N-[4-[[[2-(4-chlorophenyl)sulfanylacetyl]amino]carbamoyl]phenyl]thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-[4-[[[2-(4-chlorophenyl)sulfanylacetyl]amino]carbamoyl]phenyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 4847454 |
| Molecular Formula | C19H14Cl3N3O4S3 |
| Molecular Weight | 550.90 g/mol |
| Exact Mass | 548.92 |
| IUPAC Name | 2,5-dichloro-N-[4-[[[2-(4-chlorophenyl)sulfanylacetyl]amino]carbamoyl]phenyl]thiophene-3-sulfonamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)NNC(=O)c1ccc(NS(=O)(=O)c2cc(Cl)sc2Cl)cc1 |
| InChI | InChI=1S/C19H14Cl3N3O4S3/c20-12-3-7-14(8-4-12)30-10-17(26)23-24-19(27)11-1-5-13(6-2-11)25-32(28,29)15-9-16(21)31-18(15)22/h1-9,25H,10H2,(H,23,26)(H,24,27) |
| InChIKey | ZRAITUPOEPLUJJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.90 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|