C11H8Cl2N2O2S3 — CID 43344174
4-[(2,5-dichlorothiophen-3-yl)sulfonylamino]benzenecarbothioamide (PubChem CID 43344174) has the molecular formula C11H8Cl2N2O2S3 and a molecular weight of 367.30 g/mol. Its IUPAC name is 4-[(2,5-dichlorothiophen-3-yl)sulfonylamino]benzenecarbothioamide.
| Compound Name | 4-[(2,5-dichlorothiophen-3-yl)sulfonylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 43344174 |
| Molecular Formula | C11H8Cl2N2O2S3 |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 365.91 |
| IUPAC Name | 4-[(2,5-dichlorothiophen-3-yl)sulfonylamino]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NS(=O)(=O)c2cc(Cl)sc2Cl)cc1 |
| InChI | InChI=1S/C11H8Cl2N2O2S3/c12-9-5-8(10(13)19-9)20(16,17)15-7-3-1-6(2-4-7)11(14)18/h1-5,15H,(H2,14,18) |
| InChIKey | DIGASALUDPODAX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|