C11H7Cl3N2O3S2 — CID 34973303
4-chloro-3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]benzamide (PubChem CID 34973303) has the molecular formula C11H7Cl3N2O3S2 and a molecular weight of 385.68 g/mol. Its IUPAC name is 4-chloro-3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]benzamide.
| Compound Name | 4-chloro-3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 34973303 |
| Molecular Formula | C11H7Cl3N2O3S2 |
| Molecular Weight | 385.68 g/mol |
| Exact Mass | 383.90 |
| IUPAC Name | 4-chloro-3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]benzamide |
| SMILES | NC(=O)c1ccc(Cl)c(NS(=O)(=O)c2cc(Cl)sc2Cl)c1 |
| InChI | InChI=1S/C11H7Cl3N2O3S2/c12-6-2-1-5(11(15)17)3-7(6)16-21(18,19)8-4-9(13)20-10(8)14/h1-4,16H,(H2,15,17) |
| InChIKey | WISVZHYKZMBYJS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.68 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |