C7H8ClN3O3S — CID 112573335
4-chloro-3-(sulfamoylamino)benzamide (PubChem CID 112573335) has the molecular formula C7H8ClN3O3S and a molecular weight of 249.68 g/mol. Its IUPAC name is 4-chloro-3-(sulfamoylamino)benzamide.
| Compound Name | 4-chloro-3-(sulfamoylamino)benzamide |
|---|---|
| PubChem CID | 112573335 |
| Molecular Formula | C7H8ClN3O3S |
| Molecular Weight | 249.68 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 4-chloro-3-(sulfamoylamino)benzamide |
| SMILES | NC(=O)c1ccc(Cl)c(NS(N)(=O)=O)c1 |
| InChI | InChI=1S/C7H8ClN3O3S/c8-5-2-1-4(7(9)12)3-6(5)11-15(10,13)14/h1-3,11H,(H2,9,12)(H2,10,13,14) |
| InChIKey | ZDBDEAPLWVIYNP-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.68 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |