C11H12ClN3O2 — CID 65464421
3-[(1-aminocyclopropanecarbonyl)amino]-4-chlorobenzamide (PubChem CID 65464421) has the molecular formula C11H12ClN3O2 and a molecular weight of 253.69 g/mol. Its IUPAC name is 3-[(1-aminocyclopropanecarbonyl)amino]-4-chlorobenzamide.
| Compound Name | 3-[(1-aminocyclopropanecarbonyl)amino]-4-chlorobenzamide |
|---|---|
| PubChem CID | 65464421 |
| Molecular Formula | C11H12ClN3O2 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 3-[(1-aminocyclopropanecarbonyl)amino]-4-chlorobenzamide |
| SMILES | NC(=O)c1ccc(Cl)c(NC(=O)C2(N)CC2)c1 |
| InChI | InChI=1S/C11H12ClN3O2/c12-7-2-1-6(9(13)16)5-8(7)15-10(17)11(14)3-4-11/h1-2,5H,3-4,14H2,(H2,13,16)(H,15,17) |
| InChIKey | NYBQHHDLTKQDSX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |