C15H20ClN3O2 — CID 63130126
N-(5-carbamoyl-2-chlorophenyl)-3-ethylpiperidine-3-carboxamide (PubChem CID 63130126) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is N-(5-carbamoyl-2-chlorophenyl)-3-ethylpiperidine-3-carboxamide.
| Compound Name | N-(5-carbamoyl-2-chlorophenyl)-3-ethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 63130126 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | N-(5-carbamoyl-2-chlorophenyl)-3-ethylpiperidine-3-carboxamide |
| SMILES | CCC1(C(=O)Nc2cc(C(N)=O)ccc2Cl)CCCNC1 |
| InChI | InChI=1S/C15H20ClN3O2/c1-2-15(6-3-7-18-9-15)14(21)19-12-8-10(13(17)20)4-5-11(12)16/h4-5,8,18H,2-3,6-7,9H2,1H3,(H2,17,20)(H,19,21) |
| InChIKey | YKJGPVHRSDPXFQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |