C14H9Cl4NO3S — CID 2742129
N-(5-acetyl-2-chlorophenyl)-2,4,5-trichlorobenzenesulfonamide (PubChem CID 2742129) has the molecular formula C14H9Cl4NO3S and a molecular weight of 413.11 g/mol. Its IUPAC name is N-(5-acetyl-2-chlorophenyl)-2,4,5-trichlorobenzenesulfonamide.
| Compound Name | N-(5-acetyl-2-chlorophenyl)-2,4,5-trichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 2742129 |
| Molecular Formula | C14H9Cl4NO3S |
| Molecular Weight | 413.11 g/mol |
| Exact Mass | 410.91 |
| IUPAC Name | N-(5-acetyl-2-chlorophenyl)-2,4,5-trichlorobenzenesulfonamide |
| SMILES | CC(=O)c1ccc(Cl)c(NS(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C14H9Cl4NO3S/c1-7(20)8-2-3-9(15)13(4-8)19-23(21,22)14-6-11(17)10(16)5-12(14)18/h2-6,19H,1H3 |
| InChIKey | AGANOYHGGFJXIW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.11 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|