C15H13Cl2NO4S — CID 138998155
N-(4-acetylphenyl)-2,5-dichloro-4-methoxybenzenesulfonamide (PubChem CID 138998155) has the molecular formula C15H13Cl2NO4S and a molecular weight of 374.25 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2,5-dichloro-4-methoxybenzenesulfonamide.
| Compound Name | N-(4-acetylphenyl)-2,5-dichloro-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 138998155 |
| Molecular Formula | C15H13Cl2NO4S |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | N-(4-acetylphenyl)-2,5-dichloro-4-methoxybenzenesulfonamide |
| SMILES | COc1cc(Cl)c(S(=O)(=O)Nc2ccc(C(C)=O)cc2)cc1Cl |
| InChI | InChI=1S/C15H13Cl2NO4S/c1-9(19)10-3-5-11(6-4-10)18-23(20,21)15-8-12(16)14(22-2)7-13(15)17/h3-8,18H,1-2H3 |
| InChIKey | CNNLIIKRURNZMB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |