C14H13Cl2NO3S — CID 1258973
2,5-dichloro-4-methoxy-N-(2-methylphenyl)benzenesulfonamide (PubChem CID 1258973) has the molecular formula C14H13Cl2NO3S and a molecular weight of 346.24 g/mol. Its IUPAC name is 2,5-dichloro-4-methoxy-N-(2-methylphenyl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-4-methoxy-N-(2-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 1258973 |
| Molecular Formula | C14H13Cl2NO3S |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 2,5-dichloro-4-methoxy-N-(2-methylphenyl)benzenesulfonamide |
| SMILES | COc1cc(Cl)c(S(=O)(=O)Nc2ccccc2C)cc1Cl |
| InChI | InChI=1S/C14H13Cl2NO3S/c1-9-5-3-4-6-12(9)17-21(18,19)14-8-10(15)13(20-2)7-11(14)16/h3-8,17H,1-2H3 |
| InChIKey | JNCWVERHMMETMH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |