C15H15BrClNO4S — CID 27993653
5-bromo-N-(4-chloro-2,5-dimethoxyphenyl)-2-methylbenzenesulfonamide (PubChem CID 27993653) has the molecular formula C15H15BrClNO4S and a molecular weight of 420.71 g/mol. Its IUPAC name is 5-bromo-N-(4-chloro-2,5-dimethoxyphenyl)-2-methylbenzenesulfonamide.
| Compound Name | 5-bromo-N-(4-chloro-2,5-dimethoxyphenyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 27993653 |
| Molecular Formula | C15H15BrClNO4S |
| Molecular Weight | 420.71 g/mol |
| Exact Mass | 418.96 |
| IUPAC Name | 5-bromo-N-(4-chloro-2,5-dimethoxyphenyl)-2-methylbenzenesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2cc(Br)ccc2C)c(OC)cc1Cl |
| InChI | InChI=1S/C15H15BrClNO4S/c1-9-4-5-10(16)6-15(9)23(19,20)18-12-8-13(21-2)11(17)7-14(12)22-3/h4-8,18H,1-3H3 |
| InChIKey | CYCIDMTVINPBPL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.71 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |