C16H18BrNO5S — CID 8512676
5-bromo-2-methyl-N-(3,4,5-trimethoxyphenyl)benzenesulfonamide (PubChem CID 8512676) has the molecular formula C16H18BrNO5S and a molecular weight of 416.29 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-(3,4,5-trimethoxyphenyl)benzenesulfonamide.
| Compound Name | 5-bromo-2-methyl-N-(3,4,5-trimethoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 8512676 |
| Molecular Formula | C16H18BrNO5S |
| Molecular Weight | 416.29 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 5-bromo-2-methyl-N-(3,4,5-trimethoxyphenyl)benzenesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2cc(Br)ccc2C)cc(OC)c1OC |
| InChI | InChI=1S/C16H18BrNO5S/c1-10-5-6-11(17)7-15(10)24(19,20)18-12-8-13(21-2)16(23-4)14(9-12)22-3/h5-9,18H,1-4H3 |
| InChIKey | RIYYFXCPFSDQHD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |