C17H21NO6S — CID 39824469
4-methoxy-3-methyl-N-(3,4,5-trimethoxyphenyl)benzenesulfonamide (PubChem CID 39824469) has the molecular formula C17H21NO6S and a molecular weight of 367.42 g/mol. Its IUPAC name is 4-methoxy-3-methyl-N-(3,4,5-trimethoxyphenyl)benzenesulfonamide.
| Compound Name | 4-methoxy-3-methyl-N-(3,4,5-trimethoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 39824469 |
| Molecular Formula | C17H21NO6S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 4-methoxy-3-methyl-N-(3,4,5-trimethoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cc(OC)c(OC)c(OC)c2)cc1C |
| InChI | InChI=1S/C17H21NO6S/c1-11-8-13(6-7-14(11)21-2)25(19,20)18-12-9-15(22-3)17(24-5)16(10-12)23-4/h6-10,18H,1-5H3 |
| InChIKey | LZRDONGATGFNQP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |