C10H14BrNO5S — CID 83092973
1-bromo-N-(3,4,5-trimethoxyphenyl)methanesulfonamide (PubChem CID 83092973) has the molecular formula C10H14BrNO5S and a molecular weight of 340.20 g/mol. Its IUPAC name is 1-bromo-N-(3,4,5-trimethoxyphenyl)methanesulfonamide.
| Compound Name | 1-bromo-N-(3,4,5-trimethoxyphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 83092973 |
| Molecular Formula | C10H14BrNO5S |
| Molecular Weight | 340.20 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | 1-bromo-N-(3,4,5-trimethoxyphenyl)methanesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)CBr)cc(OC)c1OC |
| InChI | InChI=1S/C10H14BrNO5S/c1-15-8-4-7(12-18(13,14)6-11)5-9(16-2)10(8)17-3/h4-5,12H,6H2,1-3H3 |
| InChIKey | FKFWAVISZSLDRH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|