C14H22N2O6S — CID 113000933
2-(propylsulfonylamino)-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 113000933) has the molecular formula C14H22N2O6S and a molecular weight of 346.41 g/mol. Its IUPAC name is 2-(propylsulfonylamino)-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-(propylsulfonylamino)-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 113000933 |
| Molecular Formula | C14H22N2O6S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 2-(propylsulfonylamino)-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | CCCS(=O)(=O)NCC(=O)Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C14H22N2O6S/c1-5-6-23(18,19)15-9-13(17)16-10-7-11(20-2)14(22-4)12(8-10)21-3/h7-8,15H,5-6,9H2,1-4H3,(H,16,17) |
| InChIKey | YGDGFMRVFXHCKN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |