C16H26N2O6S — CID 113148409
2-[butyl(methylsulfonyl)amino]-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 113148409) has the molecular formula C16H26N2O6S and a molecular weight of 374.46 g/mol. Its IUPAC name is 2-[butyl(methylsulfonyl)amino]-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-[butyl(methylsulfonyl)amino]-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 113148409 |
| Molecular Formula | C16H26N2O6S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-[butyl(methylsulfonyl)amino]-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | CCCCN(CC(=O)Nc1cc(OC)c(OC)c(OC)c1)S(C)(=O)=O |
| InChI | InChI=1S/C16H26N2O6S/c1-6-7-8-18(25(5,20)21)11-15(19)17-12-9-13(22-2)16(24-4)14(10-12)23-3/h9-10H,6-8,11H2,1-5H3,(H,17,19) |
| InChIKey | JLPGJTFMFSFDKP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |