C16H24N2O6 — CID 113159965
2-[acetyl(2-methoxyethyl)amino]-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 113159965) has the molecular formula C16H24N2O6 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-[acetyl(2-methoxyethyl)amino]-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-[acetyl(2-methoxyethyl)amino]-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 113159965 |
| Molecular Formula | C16H24N2O6 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2-[acetyl(2-methoxyethyl)amino]-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COCCN(CC(=O)Nc1cc(OC)c(OC)c(OC)c1)C(C)=O |
| InChI | InChI=1S/C16H24N2O6/c1-11(19)18(6-7-21-2)10-15(20)17-12-8-13(22-3)16(24-5)14(9-12)23-4/h8-9H,6-7,10H2,1-5H3,(H,17,20) |
| InChIKey | MMOBBSIJEYEGDH-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |