C18H22N2O6S — CID 113000941
2-[(2-methylphenyl)sulfonylamino]-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 113000941) has the molecular formula C18H22N2O6S and a molecular weight of 394.45 g/mol. Its IUPAC name is 2-[(2-methylphenyl)sulfonylamino]-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-[(2-methylphenyl)sulfonylamino]-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 113000941 |
| Molecular Formula | C18H22N2O6S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 2-[(2-methylphenyl)sulfonylamino]-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)CNS(=O)(=O)c2ccccc2C)cc(OC)c1OC |
| InChI | InChI=1S/C18H22N2O6S/c1-12-7-5-6-8-16(12)27(22,23)19-11-17(21)20-13-9-14(24-2)18(26-4)15(10-13)25-3/h5-10,19H,11H2,1-4H3,(H,20,21) |
| InChIKey | UUEHUIQYYRGSTB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |