C18H22N2O6S — CID 17225990
3-(benzenesulfonamido)-N-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 17225990) has the molecular formula C18H22N2O6S and a molecular weight of 394.45 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | 3-(benzenesulfonamido)-N-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 17225990 |
| Molecular Formula | C18H22N2O6S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 3-(benzenesulfonamido)-N-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(NC(=O)CCNS(=O)(=O)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C18H22N2O6S/c1-24-15-11-13(12-16(25-2)18(15)26-3)20-17(21)9-10-19-27(22,23)14-7-5-4-6-8-14/h4-8,11-12,19H,9-10H2,1-3H3,(H,20,21) |
| InChIKey | CEQJPFMBOHGZDS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |