C13H22N2O5S — CID 61456060
4-amino-N-(3,4,5-trimethoxyphenyl)butane-1-sulfonamide (PubChem CID 61456060) has the molecular formula C13H22N2O5S and a molecular weight of 318.40 g/mol. Its IUPAC name is 4-amino-N-(3,4,5-trimethoxyphenyl)butane-1-sulfonamide.
| Compound Name | 4-amino-N-(3,4,5-trimethoxyphenyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 61456060 |
| Molecular Formula | C13H22N2O5S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-amino-N-(3,4,5-trimethoxyphenyl)butane-1-sulfonamide |
| SMILES | COc1cc(NS(=O)(=O)CCCCN)cc(OC)c1OC |
| InChI | InChI=1S/C13H22N2O5S/c1-18-11-8-10(9-12(19-2)13(11)20-3)15-21(16,17)7-5-4-6-14/h8-9,15H,4-7,14H2,1-3H3 |
| InChIKey | QCPGJSGTOWQYKP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|