C9H13FN2O3S — CID 114839213
2-amino-N-(4-fluoro-3-methoxyphenyl)ethanesulfonamide (PubChem CID 114839213) has the molecular formula C9H13FN2O3S and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-amino-N-(4-fluoro-3-methoxyphenyl)ethanesulfonamide.
| Compound Name | 2-amino-N-(4-fluoro-3-methoxyphenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 114839213 |
| Molecular Formula | C9H13FN2O3S |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-amino-N-(4-fluoro-3-methoxyphenyl)ethanesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)CCN)ccc1F |
| InChI | InChI=1S/C9H13FN2O3S/c1-15-9-6-7(2-3-8(9)10)12-16(13,14)5-4-11/h2-3,6,12H,4-5,11H2,1H3 |
| InChIKey | ASUCKXQWQCCRPF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |