C8H10F2N2O2S — CID 16792909
2-amino-N-(3,5-difluorophenyl)ethanesulfonamide (PubChem CID 16792909) has the molecular formula C8H10F2N2O2S and a molecular weight of 236.24 g/mol. Its IUPAC name is 2-amino-N-(3,5-difluorophenyl)ethanesulfonamide.
| Compound Name | 2-amino-N-(3,5-difluorophenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 16792909 |
| Molecular Formula | C8H10F2N2O2S |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 2-amino-N-(3,5-difluorophenyl)ethanesulfonamide |
| SMILES | NCCS(=O)(=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C8H10F2N2O2S/c9-6-3-7(10)5-8(4-6)12-15(13,14)2-1-11/h3-5,12H,1-2,11H2 |
| InChIKey | ONKZCEOYCVCSOA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |