C9H13FN2O5S2 — CID 55014078
3-fluoro-5-(2-methoxyethylsulfonylamino)benzenesulfonamide (PubChem CID 55014078) has the molecular formula C9H13FN2O5S2 and a molecular weight of 312.34 g/mol. Its IUPAC name is 3-fluoro-5-(2-methoxyethylsulfonylamino)benzenesulfonamide.
| Compound Name | 3-fluoro-5-(2-methoxyethylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 55014078 |
| Molecular Formula | C9H13FN2O5S2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 3-fluoro-5-(2-methoxyethylsulfonylamino)benzenesulfonamide |
| SMILES | COCCS(=O)(=O)Nc1cc(F)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C9H13FN2O5S2/c1-17-2-3-18(13,14)12-8-4-7(10)5-9(6-8)19(11,15)16/h4-6,12H,2-3H2,1H3,(H2,11,15,16) |
| InChIKey | OAYPZRWMXKSNIC-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |