C10H15FN2O4S2 — CID 63687706
3-(tert-butylsulfonylamino)-5-fluorobenzenesulfonamide (PubChem CID 63687706) has the molecular formula C10H15FN2O4S2 and a molecular weight of 310.37 g/mol. Its IUPAC name is 3-(tert-butylsulfonylamino)-5-fluorobenzenesulfonamide.
| Compound Name | 3-(tert-butylsulfonylamino)-5-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 63687706 |
| Molecular Formula | C10H15FN2O4S2 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 3-(tert-butylsulfonylamino)-5-fluorobenzenesulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)Nc1cc(F)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C10H15FN2O4S2/c1-10(2,3)19(16,17)13-8-4-7(11)5-9(6-8)18(12,14)15/h4-6,13H,1-3H3,(H2,12,14,15) |
| InChIKey | VTBUKOPDBCIPPA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |