C12H13FN4O3S — CID 63362226
N-(3-fluoro-5-sulfamoylphenyl)-2,5-dimethylpyrazole-3-carboxamide (PubChem CID 63362226) has the molecular formula C12H13FN4O3S and a molecular weight of 312.33 g/mol. Its IUPAC name is N-(3-fluoro-5-sulfamoylphenyl)-2,5-dimethylpyrazole-3-carboxamide.
| Compound Name | N-(3-fluoro-5-sulfamoylphenyl)-2,5-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 63362226 |
| Molecular Formula | C12H13FN4O3S |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | N-(3-fluoro-5-sulfamoylphenyl)-2,5-dimethylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cc(F)cc(S(N)(=O)=O)c2)n(C)n1 |
| InChI | InChI=1S/C12H13FN4O3S/c1-7-3-11(17(2)16-7)12(18)15-9-4-8(13)5-10(6-9)21(14,19)20/h3-6H,1-2H3,(H,15,18)(H2,14,19,20) |
| InChIKey | KZQWQVIVSSMJSH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |