C13H10ClFN2O3S — CID 61132724
2-chloro-N-(3-fluoro-5-sulfamoylphenyl)benzamide (PubChem CID 61132724) has the molecular formula C13H10ClFN2O3S and a molecular weight of 328.75 g/mol. Its IUPAC name is 2-chloro-N-(3-fluoro-5-sulfamoylphenyl)benzamide.
| Compound Name | 2-chloro-N-(3-fluoro-5-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 61132724 |
| Molecular Formula | C13H10ClFN2O3S |
| Molecular Weight | 328.75 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 2-chloro-N-(3-fluoro-5-sulfamoylphenyl)benzamide |
| SMILES | NS(=O)(=O)c1cc(F)cc(NC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C13H10ClFN2O3S/c14-12-4-2-1-3-11(12)13(18)17-9-5-8(15)6-10(7-9)21(16,19)20/h1-7H,(H,17,18)(H2,16,19,20) |
| InChIKey | BXDFVEROGMXWSC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.75 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |