C13H9Cl2FN2O3S — CID 36704856
2-chloro-N-(3-chloro-4-fluorophenyl)-5-sulfamoylbenzamide (PubChem CID 36704856) has the molecular formula C13H9Cl2FN2O3S and a molecular weight of 363.20 g/mol. Its IUPAC name is 2-chloro-N-(3-chloro-4-fluorophenyl)-5-sulfamoylbenzamide.
| Compound Name | 2-chloro-N-(3-chloro-4-fluorophenyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 36704856 |
| Molecular Formula | C13H9Cl2FN2O3S |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 2-chloro-N-(3-chloro-4-fluorophenyl)-5-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(Cl)c(C(=O)Nc2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C13H9Cl2FN2O3S/c14-10-3-2-8(22(17,20)21)6-9(10)13(19)18-7-1-4-12(16)11(15)5-7/h1-6H,(H,18,19)(H2,17,20,21) |
| InChIKey | YWLIEEPTDFLHST-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |