C14H11ClN2O5S — CID 1144108
3-[(2-chloro-5-sulfamoylbenzoyl)amino]benzoic acid (PubChem CID 1144108) has the molecular formula C14H11ClN2O5S and a molecular weight of 354.77 g/mol. Its IUPAC name is 3-[(2-chloro-5-sulfamoylbenzoyl)amino]benzoic acid.
| Compound Name | 3-[(2-chloro-5-sulfamoylbenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 1144108 |
| Molecular Formula | C14H11ClN2O5S |
| Molecular Weight | 354.77 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 3-[(2-chloro-5-sulfamoylbenzoyl)amino]benzoic acid |
| SMILES | NS(=O)(=O)c1ccc(Cl)c(C(=O)Nc2cccc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C14H11ClN2O5S/c15-12-5-4-10(23(16,21)22)7-11(12)13(18)17-9-3-1-2-8(6-9)14(19)20/h1-7H,(H,17,18)(H,19,20)(H2,16,21,22) |
| InChIKey | DPCIQCOMSPNPCR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.77 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |