C20H22ClN3O5S — CID 56511851
2-chloro-N-[3-[4-(hydroxymethyl)piperidine-1-carbonyl]phenyl]-5-sulfamoylbenzamide (PubChem CID 56511851) has the molecular formula C20H22ClN3O5S and a molecular weight of 451.93 g/mol. Its IUPAC name is 2-chloro-N-[3-[4-(hydroxymethyl)piperidine-1-carbonyl]phenyl]-5-sulfamoylbenzamide.
| Compound Name | 2-chloro-N-[3-[4-(hydroxymethyl)piperidine-1-carbonyl]phenyl]-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 56511851 |
| Molecular Formula | C20H22ClN3O5S |
| Molecular Weight | 451.93 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 2-chloro-N-[3-[4-(hydroxymethyl)piperidine-1-carbonyl]phenyl]-5-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(Cl)c(C(=O)Nc2cccc(C(=O)N3CCC(CO)CC3)c2)c1 |
| InChI | InChI=1S/C20H22ClN3O5S/c21-18-5-4-16(30(22,28)29)11-17(18)19(26)23-15-3-1-2-14(10-15)20(27)24-8-6-13(12-25)7-9-24/h1-5,10-11,13,25H,6-9,12H2,(H,23,26)(H2,22,28,29) |
| InChIKey | CEQQOYOAAMMBNH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.93 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |