C30H33ClN2O4S — CID 99951227
N-[3-(4-tert-butylbenzoyl)phenyl]-2-chloro-5-(4-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 99951227) has the molecular formula C30H33ClN2O4S and a molecular weight of 553.12 g/mol. Its IUPAC name is N-[3-(4-tert-butylbenzoyl)phenyl]-2-chloro-5-(4-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-[3-(4-tert-butylbenzoyl)phenyl]-2-chloro-5-(4-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 99951227 |
| Molecular Formula | C30H33ClN2O4S |
| Molecular Weight | 553.12 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | N-[3-(4-tert-butylbenzoyl)phenyl]-2-chloro-5-(4-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(Cl)c(C(=O)Nc3cccc(C(=O)c4ccc(C(C)(C)C)cc4)c3)c2)CC1 |
| InChI | InChI=1S/C30H33ClN2O4S/c1-20-14-16-33(17-15-20)38(36,37)25-12-13-27(31)26(19-25)29(35)32-24-7-5-6-22(18-24)28(34)21-8-10-23(11-9-21)30(2,3)4/h5-13,18-20H,14-17H2,1-4H3,(H,32,35) |
| InChIKey | ITBSNSDCZPUHPA-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.12 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |