C23H26ClN3O4S — CID 92684315
2-chloro-5-(4-methylpiperidin-1-yl)sulfonyl-N-[4-(2-oxopyrrolidin-1-yl)phenyl]benzamide (PubChem CID 92684315) has the molecular formula C23H26ClN3O4S and a molecular weight of 476.00 g/mol. Its IUPAC name is 2-chloro-5-(4-methylpiperidin-1-yl)sulfonyl-N-[4-(2-oxopyrrolidin-1-yl)phenyl]benzamide.
| Compound Name | 2-chloro-5-(4-methylpiperidin-1-yl)sulfonyl-N-[4-(2-oxopyrrolidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 92684315 |
| Molecular Formula | C23H26ClN3O4S |
| Molecular Weight | 476.00 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 2-chloro-5-(4-methylpiperidin-1-yl)sulfonyl-N-[4-(2-oxopyrrolidin-1-yl)phenyl]benzamide |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(Cl)c(C(=O)Nc3ccc(N4CCCC4=O)cc3)c2)CC1 |
| InChI | InChI=1S/C23H26ClN3O4S/c1-16-10-13-26(14-11-16)32(30,31)19-8-9-21(24)20(15-19)23(29)25-17-4-6-18(7-5-17)27-12-2-3-22(27)28/h4-9,15-16H,2-3,10-14H2,1H3,(H,25,29) |
| InChIKey | FKLHEZFPUMFKMH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.00 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |