C17H16ClN3O4S — CID 46549243
2-chloro-N-[4-(2-oxopyrrolidin-1-yl)phenyl]-5-sulfamoylbenzamide (PubChem CID 46549243) has the molecular formula C17H16ClN3O4S and a molecular weight of 393.85 g/mol. Its IUPAC name is 2-chloro-N-[4-(2-oxopyrrolidin-1-yl)phenyl]-5-sulfamoylbenzamide.
| Compound Name | 2-chloro-N-[4-(2-oxopyrrolidin-1-yl)phenyl]-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 46549243 |
| Molecular Formula | C17H16ClN3O4S |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 2-chloro-N-[4-(2-oxopyrrolidin-1-yl)phenyl]-5-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(Cl)c(C(=O)Nc2ccc(N3CCCC3=O)cc2)c1 |
| InChI | InChI=1S/C17H16ClN3O4S/c18-15-8-7-13(26(19,24)25)10-14(15)17(23)20-11-3-5-12(6-4-11)21-9-1-2-16(21)22/h3-8,10H,1-2,9H2,(H,20,23)(H2,19,24,25) |
| InChIKey | YSHMANTZSJPAFY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |