C13H9ClF2N2O3S — CID 121267983
N-(3-chloro-4-fluorophenyl)-2-fluoro-3-sulfamoylbenzamide (PubChem CID 121267983) has the molecular formula C13H9ClF2N2O3S and a molecular weight of 346.74 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-fluoro-3-sulfamoylbenzamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-fluoro-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 121267983 |
| Molecular Formula | C13H9ClF2N2O3S |
| Molecular Weight | 346.74 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-fluoro-3-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1cccc(C(=O)Nc2ccc(F)c(Cl)c2)c1F |
| InChI | InChI=1S/C13H9ClF2N2O3S/c14-9-6-7(4-5-10(9)15)18-13(19)8-2-1-3-11(12(8)16)22(17,20)21/h1-6H,(H,18,19)(H2,17,20,21) |
| InChIKey | WQBDRJZZIFHNNX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.74 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |