C19H14ClFN2O3S2 — CID 75534018
N-(3-chloro-4-fluorophenyl)-2-(4-sulfamoylphenyl)sulfanylbenzamide (PubChem CID 75534018) has the molecular formula C19H14ClFN2O3S2 and a molecular weight of 436.92 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-(4-sulfamoylphenyl)sulfanylbenzamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-(4-sulfamoylphenyl)sulfanylbenzamide |
|---|---|
| PubChem CID | 75534018 |
| Molecular Formula | C19H14ClFN2O3S2 |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-(4-sulfamoylphenyl)sulfanylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(Sc2ccccc2C(=O)Nc2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H14ClFN2O3S2/c20-16-11-12(5-10-17(16)21)23-19(24)15-3-1-2-4-18(15)27-13-6-8-14(9-7-13)28(22,25)26/h1-11H,(H,23,24)(H2,22,25,26) |
| InChIKey | DHYMWAGDOLHUEZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |