C12H9ClFN3O3S — CID 64951270
N-(3-chloro-4-sulfamoylphenyl)-3-fluoropyridine-4-carboxamide (PubChem CID 64951270) has the molecular formula C12H9ClFN3O3S and a molecular weight of 329.74 g/mol. Its IUPAC name is N-(3-chloro-4-sulfamoylphenyl)-3-fluoropyridine-4-carboxamide.
| Compound Name | N-(3-chloro-4-sulfamoylphenyl)-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 64951270 |
| Molecular Formula | C12H9ClFN3O3S |
| Molecular Weight | 329.74 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | N-(3-chloro-4-sulfamoylphenyl)-3-fluoropyridine-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2ccncc2F)cc1Cl |
| InChI | InChI=1S/C12H9ClFN3O3S/c13-9-5-7(1-2-11(9)21(15,19)20)17-12(18)8-3-4-16-6-10(8)14/h1-6H,(H,17,18)(H2,15,19,20) |
| InChIKey | ONKRXTWGYVPFFU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.74 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |