C8H10FN3O3S — CID 78993821
1-(3-fluoro-5-sulfamoylphenyl)-3-methylurea (PubChem CID 78993821) has the molecular formula C8H10FN3O3S and a molecular weight of 247.25 g/mol. Its IUPAC name is 1-(3-fluoro-5-sulfamoylphenyl)-3-methylurea.
| Compound Name | 1-(3-fluoro-5-sulfamoylphenyl)-3-methylurea |
|---|---|
| PubChem CID | 78993821 |
| Molecular Formula | C8H10FN3O3S |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 1-(3-fluoro-5-sulfamoylphenyl)-3-methylurea |
| SMILES | CNC(=O)Nc1cc(F)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C8H10FN3O3S/c1-11-8(13)12-6-2-5(9)3-7(4-6)16(10,14)15/h2-4H,1H3,(H2,10,14,15)(H2,11,12,13) |
| InChIKey | HGAULULEAUZQKQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |