C8H10FN3O3S — CID 116646026
1-(3-amino-5-fluorophenyl)sulfonyl-3-methylurea (PubChem CID 116646026) has the molecular formula C8H10FN3O3S and a molecular weight of 247.25 g/mol. Its IUPAC name is 1-(3-amino-5-fluorophenyl)sulfonyl-3-methylurea.
| Compound Name | 1-(3-amino-5-fluorophenyl)sulfonyl-3-methylurea |
|---|---|
| PubChem CID | 116646026 |
| Molecular Formula | C8H10FN3O3S |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 1-(3-amino-5-fluorophenyl)sulfonyl-3-methylurea |
| SMILES | CNC(=O)NS(=O)(=O)c1cc(N)cc(F)c1 |
| InChI | InChI=1S/C8H10FN3O3S/c1-11-8(13)12-16(14,15)7-3-5(9)2-6(10)4-7/h2-4H,10H2,1H3,(H2,11,12,13) |
| InChIKey | CDIHJPJBLNZVBU-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|