C12H19FN2O2S — CID 104827294
3-amino-N-(3,3-dimethylbutan-2-yl)-5-fluorobenzenesulfonamide (PubChem CID 104827294) has the molecular formula C12H19FN2O2S and a molecular weight of 274.36 g/mol. Its IUPAC name is 3-amino-N-(3,3-dimethylbutan-2-yl)-5-fluorobenzenesulfonamide.
| Compound Name | 3-amino-N-(3,3-dimethylbutan-2-yl)-5-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 104827294 |
| Molecular Formula | C12H19FN2O2S |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3-amino-N-(3,3-dimethylbutan-2-yl)-5-fluorobenzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1cc(N)cc(F)c1)C(C)(C)C |
| InChI | InChI=1S/C12H19FN2O2S/c1-8(12(2,3)4)15-18(16,17)11-6-9(13)5-10(14)7-11/h5-8,15H,14H2,1-4H3 |
| InChIKey | LGNSWVYPCVLDGL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|