C8H12FN3O4S2 — CID 63322264
3-amino-5-fluoro-N-(2-sulfamoylethyl)benzenesulfonamide (PubChem CID 63322264) has the molecular formula C8H12FN3O4S2 and a molecular weight of 297.33 g/mol. Its IUPAC name is 3-amino-5-fluoro-N-(2-sulfamoylethyl)benzenesulfonamide.
| Compound Name | 3-amino-5-fluoro-N-(2-sulfamoylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63322264 |
| Molecular Formula | C8H12FN3O4S2 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 3-amino-5-fluoro-N-(2-sulfamoylethyl)benzenesulfonamide |
| SMILES | Nc1cc(F)cc(S(=O)(=O)NCCS(N)(=O)=O)c1 |
| InChI | InChI=1S/C8H12FN3O4S2/c9-6-3-7(10)5-8(4-6)18(15,16)12-1-2-17(11,13)14/h3-5,12H,1-2,10H2,(H2,11,13,14) |
| InChIKey | DGZJNENXEGSHIO-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|