C14H13F2N3O3S — CID 36511499
1-[3-[(3,5-difluorophenyl)sulfonylamino]phenyl]-3-methylurea (PubChem CID 36511499) has the molecular formula C14H13F2N3O3S and a molecular weight of 341.34 g/mol. Its IUPAC name is 1-[3-[(3,5-difluorophenyl)sulfonylamino]phenyl]-3-methylurea.
| Compound Name | 1-[3-[(3,5-difluorophenyl)sulfonylamino]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 36511499 |
| Molecular Formula | C14H13F2N3O3S |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 1-[3-[(3,5-difluorophenyl)sulfonylamino]phenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1cccc(NS(=O)(=O)c2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C14H13F2N3O3S/c1-17-14(20)18-11-3-2-4-12(8-11)19-23(21,22)13-6-9(15)5-10(16)7-13/h2-8,19H,1H3,(H2,17,18,20) |
| InChIKey | URTRSPRKUVHXPE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |