C18H23N3O5S — CID 36512808
1-[3-[(3,4-diethoxyphenyl)sulfonylamino]phenyl]-3-methylurea (PubChem CID 36512808) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is 1-[3-[(3,4-diethoxyphenyl)sulfonylamino]phenyl]-3-methylurea.
| Compound Name | 1-[3-[(3,4-diethoxyphenyl)sulfonylamino]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 36512808 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 1-[3-[(3,4-diethoxyphenyl)sulfonylamino]phenyl]-3-methylurea |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cccc(NC(=O)NC)c2)cc1OCC |
| InChI | InChI=1S/C18H23N3O5S/c1-4-25-16-10-9-15(12-17(16)26-5-2)27(23,24)21-14-8-6-7-13(11-14)20-18(22)19-3/h6-12,21H,4-5H2,1-3H3,(H2,19,20,22) |
| InChIKey | FNIHIKZBAMBTJT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |