C17H21NO6S2 — CID 9056028
3,4-diethoxy-N-(4-methylsulfonylphenyl)benzenesulfonamide (PubChem CID 9056028) has the molecular formula C17H21NO6S2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 3,4-diethoxy-N-(4-methylsulfonylphenyl)benzenesulfonamide.
| Compound Name | 3,4-diethoxy-N-(4-methylsulfonylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 9056028 |
| Molecular Formula | C17H21NO6S2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 3,4-diethoxy-N-(4-methylsulfonylphenyl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(S(C)(=O)=O)cc2)cc1OCC |
| InChI | InChI=1S/C17H21NO6S2/c1-4-23-16-11-10-15(12-17(16)24-5-2)26(21,22)18-13-6-8-14(9-7-13)25(3,19)20/h6-12,18H,4-5H2,1-3H3 |
| InChIKey | KFHJMTAXFLWHEQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |