C19H24N2O5S2 — CID 56508235
S-[4-[(3,4-diethoxyphenyl)sulfonylamino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56508235) has the molecular formula C19H24N2O5S2 and a molecular weight of 424.54 g/mol. Its IUPAC name is S-[4-[(3,4-diethoxyphenyl)sulfonylamino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[(3,4-diethoxyphenyl)sulfonylamino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56508235 |
| Molecular Formula | C19H24N2O5S2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | S-[4-[(3,4-diethoxyphenyl)sulfonylamino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(SC(=O)N(C)C)cc2)cc1OCC |
| InChI | InChI=1S/C19H24N2O5S2/c1-5-25-17-12-11-16(13-18(17)26-6-2)28(23,24)20-14-7-9-15(10-8-14)27-19(22)21(3)4/h7-13,20H,5-6H2,1-4H3 |
| InChIKey | XYAWRJPXEFWIAR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|