C20H19N3O5S2 — CID 146591354
1-[3-(benzenesulfonamido)phenyl]-3-(4-methylphenyl)sulfonylurea (PubChem CID 146591354) has the molecular formula C20H19N3O5S2 and a molecular weight of 445.52 g/mol. Its IUPAC name is 1-[3-(benzenesulfonamido)phenyl]-3-(4-methylphenyl)sulfonylurea.
| Compound Name | 1-[3-(benzenesulfonamido)phenyl]-3-(4-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 146591354 |
| Molecular Formula | C20H19N3O5S2 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 1-[3-(benzenesulfonamido)phenyl]-3-(4-methylphenyl)sulfonylurea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Nc2cccc(NS(=O)(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C20H19N3O5S2/c1-15-10-12-19(13-11-15)30(27,28)23-20(24)21-16-6-5-7-17(14-16)22-29(25,26)18-8-3-2-4-9-18/h2-14,22H,1H3,(H2,21,23,24) |
| InChIKey | SXMGIPZPWBEXCU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |