C21H20N4O6S2 — CID 19607159
1-(benzenesulfonyl)-3-[3-(benzenesulfonylcarbamoylamino)-4-methylphenyl]urea (PubChem CID 19607159) has the molecular formula C21H20N4O6S2 and a molecular weight of 488.55 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-[3-(benzenesulfonylcarbamoylamino)-4-methylphenyl]urea.
| Compound Name | 1-(benzenesulfonyl)-3-[3-(benzenesulfonylcarbamoylamino)-4-methylphenyl]urea |
|---|---|
| PubChem CID | 19607159 |
| Molecular Formula | C21H20N4O6S2 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | 1-(benzenesulfonyl)-3-[3-(benzenesulfonylcarbamoylamino)-4-methylphenyl]urea |
| SMILES | Cc1ccc(NC(=O)NS(=O)(=O)c2ccccc2)cc1NC(=O)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H20N4O6S2/c1-15-12-13-16(22-20(26)24-32(28,29)17-8-4-2-5-9-17)14-19(15)23-21(27)25-33(30,31)18-10-6-3-7-11-18/h2-14H,1H3,(H2,22,24,26)(H2,23,25,27) |
| InChIKey | FERFXVXPYXKQKP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |