C16H20BN3O4S — CID 21364805
N-[2-[5-(benzenesulfonamido)-2-methylanilino]-2-oxoethyl]-methylboronamidic acid (PubChem CID 21364805) has the molecular formula C16H20BN3O4S and a molecular weight of 361.23 g/mol. Its IUPAC name is N-[2-[5-(benzenesulfonamido)-2-methylanilino]-2-oxoethyl]-methylboronamidic acid.
| Compound Name | N-[2-[5-(benzenesulfonamido)-2-methylanilino]-2-oxoethyl]-methylboronamidic acid |
|---|---|
| PubChem CID | 21364805 |
| Molecular Formula | C16H20BN3O4S |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | N-[2-[5-(benzenesulfonamido)-2-methylanilino]-2-oxoethyl]-methylboronamidic acid |
| SMILES | CB(O)NCC(=O)Nc1cc(NS(=O)(=O)c2ccccc2)ccc1C |
| InChI | InChI=1S/C16H20BN3O4S/c1-12-8-9-13(10-15(12)19-16(21)11-18-17(2)22)20-25(23,24)14-6-4-3-5-7-14/h3-10,18,20,22H,11H2,1-2H3,(H,19,21) |
| InChIKey | WMBCHTIKVLWURG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|